C19H20BrCl4N5O2 — CID 173454051
1,2-bis[(E)-(4,5-dichloro-2-ethoxyphenyl)methylideneamino]guanidine;hydrobromide (PubChem CID 173454051) has the molecular formula C19H20BrCl4N5O2 and a molecular weight of 572.12 g/mol. Its IUPAC name is 1,2-bis[(E)-(4,5-dichloro-2-ethoxyphenyl)methylideneamino]guanidine;hydrobromide.
| Compound Name | 1,2-bis[(E)-(4,5-dichloro-2-ethoxyphenyl)methylideneamino]guanidine;hydrobromide |
|---|---|
| PubChem CID | 173454051 |
| Molecular Formula | C19H20BrCl4N5O2 |
| Molecular Weight | 572.12 g/mol |
| Exact Mass | 568.96 |
| IUPAC Name | 1,2-bis[(E)-(4,5-dichloro-2-ethoxyphenyl)methylideneamino]guanidine;hydrobromide |
| SMILES | Br.CCOc1cc(Cl)c(Cl)cc1/C=N/N=C(N)N/N=C/c1cc(Cl)c(Cl)cc1OCC |
| InChI | InChI=1S/C19H19Cl4N5O2.BrH/c1-3-29-17-7-15(22)13(20)5-11(17)9-25-27-19(24)28-26-10-12-6-14(21)16(23)8-18(12)30-4-2;/h5-10H,3-4H2,1-2H3,(H3,24,27,28);1H/b25-9+,26-10+; |
| InChIKey | URLKNVYXZGQKML-MSGQZJGISA-N |
| XLogP | 5.95 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.12 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|