C11H16BrNO4 — CID 87890582
5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane (PubChem CID 87890582) has the molecular formula C11H16BrNO4 and a molecular weight of 306.16 g/mol. Its IUPAC name is 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane.
| Compound Name | 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane |
|---|---|
| PubChem CID | 87890582 |
| Molecular Formula | C11H16BrNO4 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane |
| SMILES | COC(C)OC.COc1ncc(Br)cc1C=O |
| InChI | InChI=1S/C7H6BrNO2.C4H10O2/c1-11-7-5(4-10)2-6(8)3-9-7;1-4(5-2)6-3/h2-4H,1H3;4H,1-3H3 |
| InChIKey | LTBLBIKRJWWPPM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|