About 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane
5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane (PubChem CID 87890582) has the molecular formula C11H16BrNO4
and a molecular weight of 306.16 g/mol. Its IUPAC name is 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane.
Molecular Properties
| Compound Name | 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane |
| PubChem CID | 87890582 |
| Molecular Formula | C11H16BrNO4 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane |
| SMILES | COC(C)OC.COc1ncc(Br)cc1C=O |
| InChI | InChI=1S/C7H6BrNO2.C4H10O2/c1-11-7-5(4-10)2-6(8)3-9-7;1-4(5-2)6-3/h2-4H,1H3;4H,1-3H3 |
| InChIKey | LTBLBIKRJWWPPM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane?
The IUPAC name of 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane (CID 87890582) is 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane.
What is the SMILES notation for 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane?
The canonical SMILES for 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane is COC(C)OC.COc1ncc(Br)cc1C=O.
What is the InChIKey of 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane?
The InChIKey is LTBLBIKRJWWPPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO2.C4H10O2/c1-11-7-5(4-10)2-6(8)3-9-7;1-4(5-2)6-3/h2-4H,1H3;4H,1-3H3.
What are the key properties of 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane?
5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane has a molecular weight of 306.16 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methoxypyridine-3-carbaldehyde;1,1-dimethoxyethane is sourced from PubChem (CID 87890582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).