C11H17BrN2O — CID 62292648
N-[(5-bromo-2-methoxy-3-pyridinyl)methyl]-2-methylpropan-1-amine (PubChem CID 62292648) has the molecular formula C11H17BrN2O and a molecular weight of 273.17 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxy-3-pyridinyl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-[(5-bromo-2-methoxy-3-pyridinyl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62292648 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N-[(5-bromo-2-methoxy-3-pyridinyl)methyl]-2-methylpropan-1-amine |
| SMILES | COc1ncc(Br)cc1CNCC(C)C |
| InChI | InChI=1S/C11H17BrN2O/c1-8(2)5-13-6-9-4-10(12)7-14-11(9)15-3/h4,7-8,13H,5-6H2,1-3H3 |
| InChIKey | DDCMJDGFSDSHPD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |