C16H27BrN2O2 — CID 106667606
N-[[5-bromo-2-(3-methoxy-3-methylbutoxy)-3-pyridinyl]methyl]-2-methylpropan-1-amine (PubChem CID 106667606) has the molecular formula C16H27BrN2O2 and a molecular weight of 359.31 g/mol. Its IUPAC name is N-[[5-bromo-2-(3-methoxy-3-methylbutoxy)-3-pyridinyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[5-bromo-2-(3-methoxy-3-methylbutoxy)-3-pyridinyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 106667606 |
| Molecular Formula | C16H27BrN2O2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[[5-bromo-2-(3-methoxy-3-methylbutoxy)-3-pyridinyl]methyl]-2-methylpropan-1-amine |
| SMILES | COC(C)(C)CCOc1ncc(Br)cc1CNCC(C)C |
| InChI | InChI=1S/C16H27BrN2O2/c1-12(2)9-18-10-13-8-14(17)11-19-15(13)21-7-6-16(3,4)20-5/h8,11-12,18H,6-7,9-10H2,1-5H3 |
| InChIKey | LSZGDYPELAFQCF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |