C17H31NO2S — CID 106668090
N-[[4-[(3-methoxy-3-methylbutoxy)methyl]-5-methylthiophen-2-yl]methyl]-2-methylpropan-1-amine (PubChem CID 106668090) has the molecular formula C17H31NO2S and a molecular weight of 313.51 g/mol. Its IUPAC name is N-[[4-[(3-methoxy-3-methylbutoxy)methyl]-5-methylthiophen-2-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[4-[(3-methoxy-3-methylbutoxy)methyl]-5-methylthiophen-2-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 106668090 |
| Molecular Formula | C17H31NO2S |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | N-[[4-[(3-methoxy-3-methylbutoxy)methyl]-5-methylthiophen-2-yl]methyl]-2-methylpropan-1-amine |
| SMILES | COC(C)(C)CCOCc1cc(CNCC(C)C)sc1C |
| InChI | InChI=1S/C17H31NO2S/c1-13(2)10-18-11-16-9-15(14(3)21-16)12-20-8-7-17(4,5)19-6/h9,13,18H,7-8,10-12H2,1-6H3 |
| InChIKey | WZUBTAOBQANTIN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|