C17H29NO2S — CID 80720268
2-methyl-N-[[5-methyl-4-(oxan-2-ylmethoxymethyl)thiophen-2-yl]methyl]propan-1-amine (PubChem CID 80720268) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is 2-methyl-N-[[5-methyl-4-(oxan-2-ylmethoxymethyl)thiophen-2-yl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[5-methyl-4-(oxan-2-ylmethoxymethyl)thiophen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 80720268 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-methyl-N-[[5-methyl-4-(oxan-2-ylmethoxymethyl)thiophen-2-yl]methyl]propan-1-amine |
| SMILES | Cc1sc(CNCC(C)C)cc1COCC1CCCCO1 |
| InChI | InChI=1S/C17H29NO2S/c1-13(2)9-18-10-17-8-15(14(3)21-17)11-19-12-16-6-4-5-7-20-16/h8,13,16,18H,4-7,9-12H2,1-3H3 |
| InChIKey | NTVGIDPDJPNBII-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |