C9H8BrFO3 — CID 84710945
5-bromo-4-fluoro-2,3-dimethoxybenzaldehyde (PubChem CID 84710945) has the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. Its IUPAC name is 5-bromo-4-fluoro-2,3-dimethoxybenzaldehyde.
| Compound Name | 5-bromo-4-fluoro-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 84710945 |
| Molecular Formula | C9H8BrFO3 |
| Molecular Weight | 263.06 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 5-bromo-4-fluoro-2,3-dimethoxybenzaldehyde |
| SMILES | COc1c(C=O)cc(Br)c(F)c1OC |
| InChI | InChI=1S/C9H8BrFO3/c1-13-8-5(4-12)3-6(10)7(11)9(8)14-2/h3-4H,1-2H3 |
| InChIKey | VNNAKSAJEAGVIC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.06 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|