C11H14F2O2Si — CID 14114204
2,4-difluoro-5-methoxy-3-trimethylsilylbenzaldehyde (PubChem CID 14114204) has the molecular formula C11H14F2O2Si and a molecular weight of 244.31 g/mol. Its IUPAC name is 2,4-difluoro-5-methoxy-3-trimethylsilylbenzaldehyde.
| Compound Name | 2,4-difluoro-5-methoxy-3-trimethylsilylbenzaldehyde |
|---|---|
| PubChem CID | 14114204 |
| Molecular Formula | C11H14F2O2Si |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2,4-difluoro-5-methoxy-3-trimethylsilylbenzaldehyde |
| SMILES | COc1cc(C=O)c(F)c([Si](C)(C)C)c1F |
| InChI | InChI=1S/C11H14F2O2Si/c1-15-8-5-7(6-14)9(12)11(10(8)13)16(2,3)4/h5-6H,1-4H3 |
| InChIKey | ILMSAIKEEJDSRZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|