C10H13F2IOSi — CID 164891648
(2,3-difluoro-4-iodo-6-methoxyphenyl)-trimethylsilane (PubChem CID 164891648) has the molecular formula C10H13F2IOSi and a molecular weight of 342.20 g/mol. Its IUPAC name is (2,3-difluoro-4-iodo-6-methoxyphenyl)-trimethylsilane.
| Compound Name | (2,3-difluoro-4-iodo-6-methoxyphenyl)-trimethylsilane |
|---|---|
| PubChem CID | 164891648 |
| Molecular Formula | C10H13F2IOSi |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | (2,3-difluoro-4-iodo-6-methoxyphenyl)-trimethylsilane |
| SMILES | COc1cc(I)c(F)c(F)c1[Si](C)(C)C |
| InChI | InChI=1S/C10H13F2IOSi/c1-14-7-5-6(13)8(11)9(12)10(7)15(2,3)4/h5H,1-4H3 |
| InChIKey | KTGQDMZPNXDQNI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|