C8H6I2O3 — CID 174349151
3-hydroxy-2,5-diiodo-4-methoxybenzaldehyde (PubChem CID 174349151) has the molecular formula C8H6I2O3 and a molecular weight of 403.94 g/mol. Its IUPAC name is 3-hydroxy-2,5-diiodo-4-methoxybenzaldehyde.
| Compound Name | 3-hydroxy-2,5-diiodo-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 174349151 |
| Molecular Formula | C8H6I2O3 |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.84 |
| IUPAC Name | 3-hydroxy-2,5-diiodo-4-methoxybenzaldehyde |
| SMILES | COc1c(I)cc(C=O)c(I)c1O |
| InChI | InChI=1S/C8H6I2O3/c1-13-8-5(9)2-4(3-11)6(10)7(8)12/h2-3,12H,1H3 |
| InChIKey | NQIASOYGWQZUMW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|