About 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde
2-hydroxy-3,5-diiodo-4-methylbenzaldehyde (PubChem CID 147543353) has the molecular formula C8H6I2O2
and a molecular weight of 387.94 g/mol. Its IUPAC name is 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde.
Molecular Properties
| Compound Name | 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde |
| PubChem CID | 147543353 |
| Molecular Formula | C8H6I2O2 |
| Molecular Weight | 387.94 g/mol |
| Exact Mass | 387.85 |
| IUPAC Name | 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde |
| SMILES | Cc1c(I)cc(C=O)c(O)c1I |
| InChI | InChI=1S/C8H6I2O2/c1-4-6(9)2-5(3-11)8(12)7(4)10/h2-3,12H,1H3 |
| InChIKey | FPIUBBRQWWIVDF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.94 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde?
The IUPAC name of 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde (CID 147543353) is 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde.
What is the SMILES notation for 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde?
The canonical SMILES for 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde is Cc1c(I)cc(C=O)c(O)c1I.
What is the InChIKey of 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde?
The InChIKey is FPIUBBRQWWIVDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6I2O2/c1-4-6(9)2-5(3-11)8(12)7(4)10/h2-3,12H,1H3.
What are the key properties of 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde?
2-hydroxy-3,5-diiodo-4-methylbenzaldehyde has a molecular weight of 387.94 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,5-diiodo-4-methylbenzaldehyde is sourced from PubChem (CID 147543353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).