About 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde
3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde (PubChem CID 159404564) has the molecular formula C15H13ClI2O4
and a molecular weight of 546.53 g/mol. Its IUPAC name is 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde.
Molecular Properties
| Compound Name | 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde |
| PubChem CID | 159404564 |
| Molecular Formula | C15H13ClI2O4 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 545.86 |
| IUPAC Name | 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde |
| SMILES | C=O.Cc1ccc(C=O)c(O)c1I.Oc1cccc(Cl)c1I |
| InChI | InChI=1S/C8H7IO2.C6H4ClIO.CH2O/c1-5-2-3-6(4-10)8(11)7(5)9;7-4-2-1-3-5(9)6(4)8;1-2/h2-4,11H,1H3;1-3,9H;1H2 |
| InChIKey | LNUCEPCRTWEDFB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde?
The IUPAC name of 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde (CID 159404564) is 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde.
What is the SMILES notation for 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde?
The canonical SMILES for 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde is C=O.Cc1ccc(C=O)c(O)c1I.Oc1cccc(Cl)c1I.
What is the InChIKey of 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde?
The InChIKey is LNUCEPCRTWEDFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IO2.C6H4ClIO.CH2O/c1-5-2-3-6(4-10)8(11)7(5)9;7-4-2-1-3-5(9)6(4)8;1-2/h2-4,11H,1H3;1-3,9H;1H2.
What are the key properties of 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde?
3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde has a molecular weight of 546.53 g/mol, XLogP of 4.58, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-iodophenol;formaldehyde;2-hydroxy-3-iodo-4-methylbenzaldehyde is sourced from PubChem (CID 159404564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).