C8H8Cl2O2 — CID 162040206
2,3-dichlorobenzaldehyde;methanol (PubChem CID 162040206) has the molecular formula C8H8Cl2O2 and a molecular weight of 207.06 g/mol. Its IUPAC name is 2,3-dichlorobenzaldehyde;methanol.
| Compound Name | 2,3-dichlorobenzaldehyde;methanol |
|---|---|
| PubChem CID | 162040206 |
| Molecular Formula | C8H8Cl2O2 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 2,3-dichlorobenzaldehyde;methanol |
| SMILES | CO.O=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C7H4Cl2O.CH4O/c8-6-3-1-2-5(4-10)7(6)9;1-2/h1-4H;2H,1H3 |
| InChIKey | YXEFCHDHXCNXMG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|