C8H5Cl2NO2 — CID 68646175
(2,3-dichlorophenyl)methylidenecarbamic acid (PubChem CID 68646175) has the molecular formula C8H5Cl2NO2 and a molecular weight of 218.04 g/mol. Its IUPAC name is (2,3-dichlorophenyl)methylidenecarbamic acid.
| Compound Name | (2,3-dichlorophenyl)methylidenecarbamic acid |
|---|---|
| PubChem CID | 68646175 |
| Molecular Formula | C8H5Cl2NO2 |
| Molecular Weight | 218.04 g/mol |
| Exact Mass | 216.97 |
| IUPAC Name | (2,3-dichlorophenyl)methylidenecarbamic acid |
| SMILES | O=C(O)N=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H5Cl2NO2/c9-6-3-1-2-5(7(6)10)4-11-8(12)13/h1-4H,(H,12,13) |
| InChIKey | WQLVUUXDBYADQE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.04 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|