C11H10Cl2O2 — CID 174953913
1,2-dichloro-3-ethenylbenzene;prop-2-enoic acid (PubChem CID 174953913) has the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. Its IUPAC name is 1,2-dichloro-3-ethenylbenzene;prop-2-enoic acid.
| Compound Name | 1,2-dichloro-3-ethenylbenzene;prop-2-enoic acid |
|---|---|
| PubChem CID | 174953913 |
| Molecular Formula | C11H10Cl2O2 |
| Molecular Weight | 245.10 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 1,2-dichloro-3-ethenylbenzene;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl2.C3H4O2/c1-2-6-4-3-5-7(9)8(6)10;1-2-3(4)5/h2-5H,1H2;2H,1H2,(H,4,5) |
| InChIKey | YKXCOFLFPQWBMO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.10 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|