C13H8Cl2O2S — CID 2361301
(Z)-3-(2,3-dichlorophenyl)-2-thiophen-2-ylprop-2-enoic acid (PubChem CID 2361301) has the molecular formula C13H8Cl2O2S and a molecular weight of 299.18 g/mol. Its IUPAC name is (Z)-3-(2,3-dichlorophenyl)-2-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (Z)-3-(2,3-dichlorophenyl)-2-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 2361301 |
| Molecular Formula | C13H8Cl2O2S |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | (Z)-3-(2,3-dichlorophenyl)-2-thiophen-2-ylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1cccc(Cl)c1Cl)c1cccs1 |
| InChI | InChI=1S/C13H8Cl2O2S/c14-10-4-1-3-8(12(10)15)7-9(13(16)17)11-5-2-6-18-11/h1-7H,(H,16,17)/b9-7+ |
| InChIKey | GULCXWKPNMMIEW-VQHVLOKHSA-N |
| XLogP | 4.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|