C21H18O4S — CID 22680708
(E)-3-(3-methoxy-2-phenylmethoxyphenyl)-2-thiophen-2-ylprop-2-enoic acid (PubChem CID 22680708) has the molecular formula C21H18O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is (E)-3-(3-methoxy-2-phenylmethoxyphenyl)-2-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (E)-3-(3-methoxy-2-phenylmethoxyphenyl)-2-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 22680708 |
| Molecular Formula | C21H18O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (E)-3-(3-methoxy-2-phenylmethoxyphenyl)-2-thiophen-2-ylprop-2-enoic acid |
| SMILES | COc1cccc(/C=C(\C(=O)O)c2cccs2)c1OCc1ccccc1 |
| InChI | InChI=1S/C21H18O4S/c1-24-18-10-5-9-16(13-17(21(22)23)19-11-6-12-26-19)20(18)25-14-15-7-3-2-4-8-15/h2-13H,14H2,1H3,(H,22,23)/b17-13- |
| InChIKey | QCWVACAYLMDDED-LGMDPLHJSA-N |
| XLogP | 4.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|