C15H13NO6S — CID 112720405
(E)-3-(4,5-dimethoxy-2-nitrophenyl)-2-thiophen-2-ylprop-2-enoic acid (PubChem CID 112720405) has the molecular formula C15H13NO6S and a molecular weight of 335.34 g/mol. Its IUPAC name is (E)-3-(4,5-dimethoxy-2-nitrophenyl)-2-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (E)-3-(4,5-dimethoxy-2-nitrophenyl)-2-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 112720405 |
| Molecular Formula | C15H13NO6S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | (E)-3-(4,5-dimethoxy-2-nitrophenyl)-2-thiophen-2-ylprop-2-enoic acid |
| SMILES | COc1cc(/C=C(\C(=O)O)c2cccs2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H13NO6S/c1-21-12-7-9(11(16(19)20)8-13(12)22-2)6-10(15(17)18)14-4-3-5-23-14/h3-8H,1-2H3,(H,17,18)/b10-6- |
| InChIKey | SVOMHILPGHPZEH-POHAHGRESA-N |
| XLogP | 3.30 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|