C17H14FNO6 — CID 112720399
(Z)-3-(4,5-dimethoxy-2-nitrophenyl)-2-(4-fluorophenyl)prop-2-enoic acid (PubChem CID 112720399) has the molecular formula C17H14FNO6 and a molecular weight of 347.30 g/mol. Its IUPAC name is (Z)-3-(4,5-dimethoxy-2-nitrophenyl)-2-(4-fluorophenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(4,5-dimethoxy-2-nitrophenyl)-2-(4-fluorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 112720399 |
| Molecular Formula | C17H14FNO6 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (Z)-3-(4,5-dimethoxy-2-nitrophenyl)-2-(4-fluorophenyl)prop-2-enoic acid |
| SMILES | COc1cc(/C=C(\C(=O)O)c2ccc(F)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H14FNO6/c1-24-15-8-11(14(19(22)23)9-16(15)25-2)7-13(17(20)21)10-3-5-12(18)6-4-10/h3-9H,1-2H3,(H,20,21)/b13-7- |
| InChIKey | JGMBPMABQDTHFU-QPEQYQDCSA-N |
| XLogP | 3.38 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|