C19H20O5 — CID 83953150
(Z)-2-(4-methylphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-enoic acid (PubChem CID 83953150) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is (Z)-2-(4-methylphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(4-methylphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83953150 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (Z)-2-(4-methylphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(\C(=O)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20O5/c1-12-5-7-13(8-6-12)15(19(20)21)9-14-10-17(23-3)18(24-4)11-16(14)22-2/h5-11H,1-4H3,(H,20,21)/b15-9- |
| InChIKey | WRUBYFQSOZPWND-DHDCSXOGSA-N |
| XLogP | 3.65 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|