3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid

C17H15NO6 — CID 145381862

IUPAC3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid
SMILESCOc1ccc(OC)c(C=C(C(=O)O)c2ccc([N+](=O)[O-])cc2)c1
InChIInChI=1S/C17H15NO6/c1-23-14-7-8-16(24-2)12(9-14)10-15(17(19)20)11-3-5-13(6-4-11)18(21)22/h3-10H,1-2H3,(H,19,20)
InChIKeyRYASRGJGUIREJM-UHFFFAOYSA-N
MW329.31 g/mol
LogP3.24
Rot. Bonds6

About 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid

3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid (PubChem CID 145381862) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid
PubChem CID145381862
Molecular FormulaC17H15NO6
Molecular Weight329.31 g/mol
Exact Mass329.09
IUPAC Name3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid
SMILESCOc1ccc(OC)c(C=C(C(=O)O)c2ccc([N+](=O)[O-])cc2)c1
InChIInChI=1S/C17H15NO6/c1-23-14-7-8-16(24-2)12(9-14)10-15(17(19)20)11-3-5-13(6-4-11)18(21)22/h3-10H,1-2H3,(H,19,20)
InChIKeyRYASRGJGUIREJM-UHFFFAOYSA-N
XLogP3.24
TPSA98.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.31
LogP ≤ 53.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid?
The IUPAC name of 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid (CID 145381862) is 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid.
What is the SMILES notation for 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid?
The canonical SMILES for 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid is COc1ccc(OC)c(C=C(C(=O)O)c2ccc([N+](=O)[O-])cc2)c1.
What is the InChIKey of 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid?
The InChIKey is RYASRGJGUIREJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO6/c1-23-14-7-8-16(24-2)12(9-14)10-15(17(19)20)11-3-5-13(6-4-11)18(21)22/h3-10H,1-2H3,(H,19,20).
What are the key properties of 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid?
3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid has a molecular weight of 329.31 g/mol, XLogP of 3.24, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid is sourced from PubChem (CID 145381862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).