C17H15NO6 — CID 145381862
3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid (PubChem CID 145381862) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid.
| Compound Name | 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 145381862 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-2-(4-nitrophenyl)prop-2-enoic acid |
| SMILES | COc1ccc(OC)c(C=C(C(=O)O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C17H15NO6/c1-23-14-7-8-16(24-2)12(9-14)10-15(17(19)20)11-3-5-13(6-4-11)18(21)22/h3-10H,1-2H3,(H,19,20) |
| InChIKey | RYASRGJGUIREJM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|