C16H13NO7 — CID 112720092
(Z)-3-(2-hydroxy-3-methoxy-5-nitrophenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid (PubChem CID 112720092) has the molecular formula C16H13NO7 and a molecular weight of 331.28 g/mol. Its IUPAC name is (Z)-3-(2-hydroxy-3-methoxy-5-nitrophenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(2-hydroxy-3-methoxy-5-nitrophenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 112720092 |
| Molecular Formula | C16H13NO7 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (Z)-3-(2-hydroxy-3-methoxy-5-nitrophenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=C(\C(=O)O)c2cccc(O)c2)c1O |
| InChI | InChI=1S/C16H13NO7/c1-24-14-8-11(17(22)23)5-10(15(14)19)7-13(16(20)21)9-3-2-4-12(18)6-9/h2-8,18-19H,1H3,(H,20,21)/b13-7- |
| InChIKey | DRGYDULZLGBQPA-QPEQYQDCSA-N |
| XLogP | 2.64 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|