C12H15NO4 — CID 55016919
1,4-dimethoxy-2-[(E)-2-nitrobut-1-enyl]benzene (PubChem CID 55016919) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 1,4-dimethoxy-2-[(E)-2-nitrobut-1-enyl]benzene.
| Compound Name | 1,4-dimethoxy-2-[(E)-2-nitrobut-1-enyl]benzene |
|---|---|
| PubChem CID | 55016919 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1,4-dimethoxy-2-[(E)-2-nitrobut-1-enyl]benzene |
| SMILES | CC/C(=C\c1cc(OC)ccc1OC)[N+](=O)[O-] |
| InChI | InChI=1S/C12H15NO4/c1-4-10(13(14)15)7-9-8-11(16-2)5-6-12(9)17-3/h5-8H,4H2,1-3H3/b10-7+ |
| InChIKey | IJEJVSFRSPCLJI-JXMROGBWSA-N |
| XLogP | 2.73 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|