C12H14BrNO4 — CID 174223066
1-bromo-2,5-dimethoxy-4-(2-nitrobut-1-enyl)benzene (PubChem CID 174223066) has the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. Its IUPAC name is 1-bromo-2,5-dimethoxy-4-(2-nitrobut-1-enyl)benzene.
| Compound Name | 1-bromo-2,5-dimethoxy-4-(2-nitrobut-1-enyl)benzene |
|---|---|
| PubChem CID | 174223066 |
| Molecular Formula | C12H14BrNO4 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 1-bromo-2,5-dimethoxy-4-(2-nitrobut-1-enyl)benzene |
| SMILES | CCC(=Cc1cc(OC)c(Br)cc1OC)[N+](=O)[O-] |
| InChI | InChI=1S/C12H14BrNO4/c1-4-9(14(15)16)5-8-6-12(18-3)10(13)7-11(8)17-2/h5-7H,4H2,1-3H3 |
| InChIKey | WQSCHZWDJVRGLM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|