C23H22O4S — CID 20989344
(Z)-3-[3-methoxy-4-(3-phenylpropoxy)phenyl]-2-thiophen-2-ylprop-2-enoic acid (PubChem CID 20989344) has the molecular formula C23H22O4S and a molecular weight of 394.49 g/mol. Its IUPAC name is (Z)-3-[3-methoxy-4-(3-phenylpropoxy)phenyl]-2-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (Z)-3-[3-methoxy-4-(3-phenylpropoxy)phenyl]-2-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 20989344 |
| Molecular Formula | C23H22O4S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (Z)-3-[3-methoxy-4-(3-phenylpropoxy)phenyl]-2-thiophen-2-ylprop-2-enoic acid |
| SMILES | COc1cc(/C=C(/C(=O)O)c2cccs2)ccc1OCCCc1ccccc1 |
| InChI | InChI=1S/C23H22O4S/c1-26-21-16-18(15-19(23(24)25)22-10-6-14-28-22)11-12-20(21)27-13-5-9-17-7-3-2-4-8-17/h2-4,6-8,10-12,14-16H,5,9,13H2,1H3,(H,24,25)/b19-15+ |
| InChIKey | ZVEIYWQHIREDGC-XDJHFCHBSA-N |
| XLogP | 5.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|