C22H19FO4S — CID 20990756
(E)-3-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid (PubChem CID 20990756) has the molecular formula C22H19FO4S and a molecular weight of 398.46 g/mol. Its IUPAC name is (E)-3-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (E)-3-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 20990756 |
| Molecular Formula | C22H19FO4S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (E)-3-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid |
| SMILES | CCOc1cc(/C=C(\C(=O)O)c2cccs2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H19FO4S/c1-2-26-20-13-16(12-18(22(24)25)21-4-3-11-28-21)7-10-19(20)27-14-15-5-8-17(23)9-6-15/h3-13H,2,14H2,1H3,(H,24,25)/b18-12- |
| InChIKey | DASKWHHKWGGOQY-PDGQHHTCSA-N |
| XLogP | 5.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|