C25H20FNO4 — CID 126396197
4-[[4-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]-2-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126396197) has the molecular formula C25H20FNO4 and a molecular weight of 417.44 g/mol. Its IUPAC name is 4-[[4-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]-2-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]-2-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126396197 |
| Molecular Formula | C25H20FNO4 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 4-[[4-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]-2-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C(/C#N)c2cccc(F)c2)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H20FNO4/c1-2-30-24-13-18(12-21(15-27)20-4-3-5-22(26)14-20)8-11-23(24)31-16-17-6-9-19(10-7-17)25(28)29/h3-14H,2,16H2,1H3,(H,28,29)/b21-12- |
| InChIKey | JCRGTFALAMPVEI-MTJSOVHGSA-N |
| XLogP | 5.57 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|