C23H21NO5 — CID 68515523
2-aminooxy-3-[2,3-bis(phenylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 68515523) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 2-aminooxy-3-[2,3-bis(phenylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 2-aminooxy-3-[2,3-bis(phenylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68515523 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-aminooxy-3-[2,3-bis(phenylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | NOC(=Cc1cccc(OCc2ccccc2)c1OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H21NO5/c24-29-21(23(25)26)14-19-12-7-13-20(27-15-17-8-3-1-4-9-17)22(19)28-16-18-10-5-2-6-11-18/h1-14H,15-16,24H2,(H,25,26) |
| InChIKey | RCXOROHNPZEYOL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|