C15H11Br2ClO — CID 141333067
2-chloro-1-(2,2-dibromoethenyl)-3-phenylmethoxybenzene (PubChem CID 141333067) has the molecular formula C15H11Br2ClO and a molecular weight of 402.51 g/mol. Its IUPAC name is 2-chloro-1-(2,2-dibromoethenyl)-3-phenylmethoxybenzene.
| Compound Name | 2-chloro-1-(2,2-dibromoethenyl)-3-phenylmethoxybenzene |
|---|---|
| PubChem CID | 141333067 |
| Molecular Formula | C15H11Br2ClO |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 399.89 |
| IUPAC Name | 2-chloro-1-(2,2-dibromoethenyl)-3-phenylmethoxybenzene |
| SMILES | Clc1c(C=C(Br)Br)cccc1OCc1ccccc1 |
| InChI | InChI=1S/C15H11Br2ClO/c16-14(17)9-12-7-4-8-13(15(12)18)19-10-11-5-2-1-3-6-11/h1-9H,10H2 |
| InChIKey | JWEZSECLQMHRKW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |