C13H5F5O2S — CID 43169990
(E)-3-(2,3,4,5,6-pentafluorophenyl)-2-thiophen-2-ylprop-2-enoic acid (PubChem CID 43169990) has the molecular formula C13H5F5O2S and a molecular weight of 320.24 g/mol. Its IUPAC name is (E)-3-(2,3,4,5,6-pentafluorophenyl)-2-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (E)-3-(2,3,4,5,6-pentafluorophenyl)-2-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 43169990 |
| Molecular Formula | C13H5F5O2S |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | (E)-3-(2,3,4,5,6-pentafluorophenyl)-2-thiophen-2-ylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1c(F)c(F)c(F)c(F)c1F)c1cccs1 |
| InChI | InChI=1S/C13H5F5O2S/c14-8-6(9(15)11(17)12(18)10(8)16)4-5(13(19)20)7-2-1-3-21-7/h1-4H,(H,19,20)/b5-4- |
| InChIKey | GHVGUHZROCSGKS-PLNGDYQASA-N |
| XLogP | 4.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|