C21H17FO4S — CID 22685046
(E)-3-[4-[2-(4-fluorophenoxy)ethoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid (PubChem CID 22685046) has the molecular formula C21H17FO4S and a molecular weight of 384.43 g/mol. Its IUPAC name is (E)-3-[4-[2-(4-fluorophenoxy)ethoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-(4-fluorophenoxy)ethoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 22685046 |
| Molecular Formula | C21H17FO4S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (E)-3-[4-[2-(4-fluorophenoxy)ethoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc(OCCOc2ccc(F)cc2)cc1)c1cccs1 |
| InChI | InChI=1S/C21H17FO4S/c22-16-5-9-18(10-6-16)26-12-11-25-17-7-3-15(4-8-17)14-19(21(23)24)20-2-1-13-27-20/h1-10,13-14H,11-12H2,(H,23,24)/b19-14- |
| InChIKey | VKKITSJKPKKJBE-RGEXLXHISA-N |
| XLogP | 4.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|