C22H20O4S — CID 20985636
(E)-3-[3-[2-(3-methylphenoxy)ethoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid (PubChem CID 20985636) has the molecular formula C22H20O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is (E)-3-[3-[2-(3-methylphenoxy)ethoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-(3-methylphenoxy)ethoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 20985636 |
| Molecular Formula | C22H20O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (E)-3-[3-[2-(3-methylphenoxy)ethoxy]phenyl]-2-thiophen-2-ylprop-2-enoic acid |
| SMILES | Cc1cccc(OCCOc2cccc(/C=C(\C(=O)O)c3cccs3)c2)c1 |
| InChI | InChI=1S/C22H20O4S/c1-16-5-2-7-18(13-16)25-10-11-26-19-8-3-6-17(14-19)15-20(22(23)24)21-9-4-12-27-21/h2-9,12-15H,10-11H2,1H3,(H,23,24)/b20-15- |
| InChIKey | JBLHVBCJAYGLFK-HKWRFOASSA-N |
| XLogP | 5.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|