C21H19NO3S — CID 9489216
N-[2-(3-methylphenoxy)ethyl]-2-(thiophene-2-carbonyl)benzamide (PubChem CID 9489216) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[2-(3-methylphenoxy)ethyl]-2-(thiophene-2-carbonyl)benzamide.
| Compound Name | N-[2-(3-methylphenoxy)ethyl]-2-(thiophene-2-carbonyl)benzamide |
|---|---|
| PubChem CID | 9489216 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[2-(3-methylphenoxy)ethyl]-2-(thiophene-2-carbonyl)benzamide |
| SMILES | Cc1cccc(OCCNC(=O)c2ccccc2C(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H19NO3S/c1-15-6-4-7-16(14-15)25-12-11-22-21(24)18-9-3-2-8-17(18)20(23)19-10-5-13-26-19/h2-10,13-14H,11-12H2,1H3,(H,22,24) |
| InChIKey | LRRCAXWXUXNWCE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|