C21H18O3S — CID 20992525
(Z)-3-[4-(3,4-dimethylphenoxy)phenyl]-2-thiophen-2-ylprop-2-enoic acid (PubChem CID 20992525) has the molecular formula C21H18O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is (Z)-3-[4-(3,4-dimethylphenoxy)phenyl]-2-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (Z)-3-[4-(3,4-dimethylphenoxy)phenyl]-2-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 20992525 |
| Molecular Formula | C21H18O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (Z)-3-[4-(3,4-dimethylphenoxy)phenyl]-2-thiophen-2-ylprop-2-enoic acid |
| SMILES | Cc1ccc(Oc2ccc(/C=C(/C(=O)O)c3cccs3)cc2)cc1C |
| InChI | InChI=1S/C21H18O3S/c1-14-5-8-18(12-15(14)2)24-17-9-6-16(7-10-17)13-19(21(22)23)20-4-3-11-25-20/h3-13H,1-2H3,(H,22,23)/b19-13+ |
| InChIKey | TWKJAJKPBPYQBF-CPNJWEJPSA-N |
| XLogP | 5.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|