C19H20O3 — CID 22682893
(Z)-3-(3-butoxyphenyl)-2-phenylprop-2-enoic acid (PubChem CID 22682893) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (Z)-3-(3-butoxyphenyl)-2-phenylprop-2-enoic acid.
| Compound Name | (Z)-3-(3-butoxyphenyl)-2-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 22682893 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (Z)-3-(3-butoxyphenyl)-2-phenylprop-2-enoic acid |
| SMILES | CCCCOc1cccc(/C=C(\C(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H20O3/c1-2-3-12-22-17-11-7-8-15(13-17)14-18(19(20)21)16-9-5-4-6-10-16/h4-11,13-14H,2-3,12H2,1H3,(H,20,21)/b18-14- |
| InChIKey | DXQKJNJTSDZNML-JXAWBTAJSA-N |
| XLogP | 4.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|