C19H20O3 — CID 83954778
(Z)-2-(3,4-dimethylphenyl)-3-(3-ethoxyphenyl)prop-2-enoic acid (PubChem CID 83954778) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (Z)-2-(3,4-dimethylphenyl)-3-(3-ethoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(3,4-dimethylphenyl)-3-(3-ethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83954778 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (Z)-2-(3,4-dimethylphenyl)-3-(3-ethoxyphenyl)prop-2-enoic acid |
| SMILES | CCOc1cccc(/C=C(\C(=O)O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C19H20O3/c1-4-22-17-7-5-6-15(11-17)12-18(19(20)21)16-9-8-13(2)14(3)10-16/h5-12H,4H2,1-3H3,(H,20,21)/b18-12- |
| InChIKey | JWNLWTUVFFXYDP-PDGQHHTCSA-N |
| XLogP | 4.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|