(Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid

C17H15FO2 — CID 83952414

IUPAC(Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid
SMILESCc1ccc(/C(=C/c2cccc(F)c2)C(=O)O)cc1C
InChIInChI=1S/C17H15FO2/c1-11-6-7-14(8-12(11)2)16(17(19)20)10-13-4-3-5-15(18)9-13/h3-10H,1-2H3,(H,19,20)/b16-10-
InChIKeyWHFWZVBHDOUTQF-YBEGLDIGSA-N
MW270.30 g/mol
LogP4.07
Rot. Bonds3

About (Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid

(Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid (PubChem CID 83952414) has the molecular formula C17H15FO2 and a molecular weight of 270.30 g/mol. Its IUPAC name is (Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid.

Molecular Properties

Compound Name(Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid
PubChem CID83952414
Molecular FormulaC17H15FO2
Molecular Weight270.30 g/mol
Exact Mass270.11
IUPAC Name(Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid
SMILESCc1ccc(/C(=C/c2cccc(F)c2)C(=O)O)cc1C
InChIInChI=1S/C17H15FO2/c1-11-6-7-14(8-12(11)2)16(17(19)20)10-13-4-3-5-15(18)9-13/h3-10H,1-2H3,(H,19,20)/b16-10-
InChIKeyWHFWZVBHDOUTQF-YBEGLDIGSA-N
XLogP4.07
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.30
LogP ≤ 54.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze (Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid?
The IUPAC name of (Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid (CID 83952414) is (Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid.
What is the SMILES notation for (Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid?
The canonical SMILES for (Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid is Cc1ccc(/C(=C/c2cccc(F)c2)C(=O)O)cc1C.
What is the InChIKey of (Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid?
The InChIKey is WHFWZVBHDOUTQF-YBEGLDIGSA-N. The full InChI is InChI=1S/C17H15FO2/c1-11-6-7-14(8-12(11)2)16(17(19)20)10-13-4-3-5-15(18)9-13/h3-10H,1-2H3,(H,19,20)/b16-10-.
What are the key properties of (Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid?
(Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid has a molecular weight of 270.30 g/mol, XLogP of 4.07, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(3,4-dimethylphenyl)-3-(3-fluorophenyl)prop-2-enoic acid is sourced from PubChem (CID 83952414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).