(E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid

C17H16O4 — CID 13378251

IUPAC(E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid
SMILESCOc1cccc(/C=C(/C(=O)O)c2cccc(OC)c2)c1
InChIInChI=1S/C17H16O4/c1-20-14-7-3-5-12(9-14)10-16(17(18)19)13-6-4-8-15(11-13)21-2/h3-11H,1-2H3,(H,18,19)/b16-10+
InChIKeyNSMLKKHUPQYECT-MHWRWJLKSA-N
MW284.31 g/mol
LogP3.33
Rot. Bonds5

About (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid

(E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid (PubChem CID 13378251) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid
PubChem CID13378251
Molecular FormulaC17H16O4
Molecular Weight284.31 g/mol
Exact Mass284.10
IUPAC Name(E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid
SMILESCOc1cccc(/C=C(/C(=O)O)c2cccc(OC)c2)c1
InChIInChI=1S/C17H16O4/c1-20-14-7-3-5-12(9-14)10-16(17(18)19)13-6-4-8-15(11-13)21-2/h3-11H,1-2H3,(H,18,19)/b16-10+
InChIKeyNSMLKKHUPQYECT-MHWRWJLKSA-N
XLogP3.33
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.31
LogP ≤ 53.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid?
The IUPAC name of (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid (CID 13378251) is (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid.
What is the SMILES notation for (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid?
The canonical SMILES for (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid is COc1cccc(/C=C(/C(=O)O)c2cccc(OC)c2)c1.
What is the InChIKey of (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid?
The InChIKey is NSMLKKHUPQYECT-MHWRWJLKSA-N. The full InChI is InChI=1S/C17H16O4/c1-20-14-7-3-5-12(9-14)10-16(17(18)19)13-6-4-8-15(11-13)21-2/h3-11H,1-2H3,(H,18,19)/b16-10+.
What are the key properties of (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid?
(E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid has a molecular weight of 284.31 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid is sourced from PubChem (CID 13378251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).