C17H16O4 — CID 13378251
(E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid (PubChem CID 13378251) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 13378251 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (E)-2,3-bis(3-methoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cccc(/C=C(/C(=O)O)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C17H16O4/c1-20-14-7-3-5-12(9-14)10-16(17(18)19)13-6-4-8-15(11-13)21-2/h3-11H,1-2H3,(H,18,19)/b16-10+ |
| InChIKey | NSMLKKHUPQYECT-MHWRWJLKSA-N |
| XLogP | 3.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|