C39H36O5 — CID 164679248
1-methoxy-3-[(1E,3Z)-1,3,4-tris(3-methoxyphenyl)-1-(4-methoxyphenyl)buta-1,3-dien-2-yl]benzene (PubChem CID 164679248) has the molecular formula C39H36O5 and a molecular weight of 584.71 g/mol. Its IUPAC name is 1-methoxy-3-[(1E,3Z)-1,3,4-tris(3-methoxyphenyl)-1-(4-methoxyphenyl)buta-1,3-dien-2-yl]benzene.
| Compound Name | 1-methoxy-3-[(1E,3Z)-1,3,4-tris(3-methoxyphenyl)-1-(4-methoxyphenyl)buta-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 164679248 |
| Molecular Formula | C39H36O5 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 1-methoxy-3-[(1E,3Z)-1,3,4-tris(3-methoxyphenyl)-1-(4-methoxyphenyl)buta-1,3-dien-2-yl]benzene |
| SMILES | COc1ccc(/C(=C(C(=C/c2cccc(OC)c2)\c2cccc(OC)c2)/c2cccc(OC)c2)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C39H36O5/c1-40-32-20-18-28(19-21-32)38(30-12-8-16-35(25-30)43-4)39(31-13-9-17-36(26-31)44-5)37(29-11-7-15-34(24-29)42-3)23-27-10-6-14-33(22-27)41-2/h6-26H,1-5H3/b37-23-,39-38+ |
| InChIKey | KGWVMGZIJXRDCJ-AEAMFSQYSA-N |
| XLogP | 8.93 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|