C8H7BCl2O2 — CID 81222802
[(E)-2-(2,3-dichlorophenyl)ethenyl]boronic acid (PubChem CID 81222802) has the molecular formula C8H7BCl2O2 and a molecular weight of 216.86 g/mol. Its IUPAC name is [(E)-2-(2,3-dichlorophenyl)ethenyl]boronic acid.
| Compound Name | [(E)-2-(2,3-dichlorophenyl)ethenyl]boronic acid |
|---|---|
| PubChem CID | 81222802 |
| Molecular Formula | C8H7BCl2O2 |
| Molecular Weight | 216.86 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | [(E)-2-(2,3-dichlorophenyl)ethenyl]boronic acid |
| SMILES | OB(O)/C=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H7BCl2O2/c10-7-3-1-2-6(8(7)11)4-5-9(12)13/h1-5,12-13H/b5-4+ |
| InChIKey | CCGTVBLWJKXOHM-SNAWJCMRSA-N |
| XLogP | 2.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.86 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|