C8H7NO5 — CID 175215295
2,3-dihydroxy-4-methyl-5-nitrobenzaldehyde (PubChem CID 175215295) has the molecular formula C8H7NO5 and a molecular weight of 197.15 g/mol. Its IUPAC name is 2,3-dihydroxy-4-methyl-5-nitrobenzaldehyde.
| Compound Name | 2,3-dihydroxy-4-methyl-5-nitrobenzaldehyde |
|---|---|
| PubChem CID | 175215295 |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 2,3-dihydroxy-4-methyl-5-nitrobenzaldehyde |
| SMILES | Cc1c([N+](=O)[O-])cc(C=O)c(O)c1O |
| InChI | InChI=1S/C8H7NO5/c1-4-6(9(13)14)2-5(3-10)8(12)7(4)11/h2-3,11-12H,1H3 |
| InChIKey | QVLMVCQKGGNUSQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|