C7H4N2O6 — CID 118176049
4-hydroxy-2,5-dinitrobenzaldehyde (PubChem CID 118176049) has the molecular formula C7H4N2O6 and a molecular weight of 212.12 g/mol. Its IUPAC name is 4-hydroxy-2,5-dinitrobenzaldehyde.
| Compound Name | 4-hydroxy-2,5-dinitrobenzaldehyde |
|---|---|
| PubChem CID | 118176049 |
| Molecular Formula | C7H4N2O6 |
| Molecular Weight | 212.12 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 4-hydroxy-2,5-dinitrobenzaldehyde |
| SMILES | O=Cc1cc([N+](=O)[O-])c(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4N2O6/c10-3-4-1-6(9(14)15)7(11)2-5(4)8(12)13/h1-3,11H |
| InChIKey | CTQDXXQNWXESOT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.12 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|