About 4-hydroxy-3-nitrobenzaldehyde;iodomethane
4-hydroxy-3-nitrobenzaldehyde;iodomethane (PubChem CID 174399047) has the molecular formula C8H8INO4
and a molecular weight of 309.06 g/mol. Its IUPAC name is 4-hydroxy-3-nitrobenzaldehyde;iodomethane.
Molecular Properties
| Compound Name | 4-hydroxy-3-nitrobenzaldehyde;iodomethane |
| PubChem CID | 174399047 |
| Molecular Formula | C8H8INO4 |
| Molecular Weight | 309.06 g/mol |
| Exact Mass | 308.95 |
| IUPAC Name | 4-hydroxy-3-nitrobenzaldehyde;iodomethane |
| SMILES | CI.O=Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5NO4.CH3I/c9-4-5-1-2-7(10)6(3-5)8(11)12;1-2/h1-4,10H;1H3 |
| InChIKey | CMJKHWGZZSJMSU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.06 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-nitrobenzaldehyde;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-nitrobenzaldehyde;iodomethane?
The IUPAC name of 4-hydroxy-3-nitrobenzaldehyde;iodomethane (CID 174399047) is 4-hydroxy-3-nitrobenzaldehyde;iodomethane.
What is the SMILES notation for 4-hydroxy-3-nitrobenzaldehyde;iodomethane?
The canonical SMILES for 4-hydroxy-3-nitrobenzaldehyde;iodomethane is CI.O=Cc1ccc(O)c([N+](=O)[O-])c1.
What is the InChIKey of 4-hydroxy-3-nitrobenzaldehyde;iodomethane?
The InChIKey is CMJKHWGZZSJMSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4.CH3I/c9-4-5-1-2-7(10)6(3-5)8(11)12;1-2/h1-4,10H;1H3.
What are the key properties of 4-hydroxy-3-nitrobenzaldehyde;iodomethane?
4-hydroxy-3-nitrobenzaldehyde;iodomethane has a molecular weight of 309.06 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-nitrobenzaldehyde;iodomethane is sourced from PubChem (CID 174399047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).