C15H14N2O10 — CID 162216424
3,4-dihydroxy-5-nitrobenzaldehyde;4,5-dihydroxy-2-nitrobenzaldehyde;methane (PubChem CID 162216424) has the molecular formula C15H14N2O10 and a molecular weight of 382.28 g/mol. Its IUPAC name is 3,4-dihydroxy-5-nitrobenzaldehyde;4,5-dihydroxy-2-nitrobenzaldehyde;methane.
| Compound Name | 3,4-dihydroxy-5-nitrobenzaldehyde;4,5-dihydroxy-2-nitrobenzaldehyde;methane |
|---|---|
| PubChem CID | 162216424 |
| Molecular Formula | C15H14N2O10 |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 3,4-dihydroxy-5-nitrobenzaldehyde;4,5-dihydroxy-2-nitrobenzaldehyde;methane |
| SMILES | C.O=Cc1cc(O)c(O)c([N+](=O)[O-])c1.O=Cc1cc(O)c(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/2C7H5NO5.CH4/c9-3-4-1-6(10)7(11)2-5(4)8(12)13;9-3-4-1-5(8(12)13)7(11)6(10)2-4;/h2*1-3,10-11H;1H4 |
| InChIKey | ZTNITZLEMZSBDS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 201.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|