About 4-bromo-3,5-dinitrobenzaldehyde
4-bromo-3,5-dinitrobenzaldehyde (PubChem CID 91286899) has the molecular formula C7H3BrN2O5
and a molecular weight of 275.01 g/mol. Its IUPAC name is 4-bromo-3,5-dinitrobenzaldehyde.
Molecular Properties
| Compound Name | 4-bromo-3,5-dinitrobenzaldehyde |
| PubChem CID | 91286899 |
| Molecular Formula | C7H3BrN2O5 |
| Molecular Weight | 275.01 g/mol |
| Exact Mass | 273.92 |
| IUPAC Name | 4-bromo-3,5-dinitrobenzaldehyde |
| SMILES | O=Cc1cc([N+](=O)[O-])c(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H3BrN2O5/c8-7-5(9(12)13)1-4(3-11)2-6(7)10(14)15/h1-3H |
| InChIKey | HLWYGPNOVZPODO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.01 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3,5-dinitrobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3,5-dinitrobenzaldehyde?
The IUPAC name of 4-bromo-3,5-dinitrobenzaldehyde (CID 91286899) is 4-bromo-3,5-dinitrobenzaldehyde.
What is the SMILES notation for 4-bromo-3,5-dinitrobenzaldehyde?
The canonical SMILES for 4-bromo-3,5-dinitrobenzaldehyde is O=Cc1cc([N+](=O)[O-])c(Br)c([N+](=O)[O-])c1.
What is the InChIKey of 4-bromo-3,5-dinitrobenzaldehyde?
The InChIKey is HLWYGPNOVZPODO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrN2O5/c8-7-5(9(12)13)1-4(3-11)2-6(7)10(14)15/h1-3H.
What are the key properties of 4-bromo-3,5-dinitrobenzaldehyde?
4-bromo-3,5-dinitrobenzaldehyde has a molecular weight of 275.01 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3,5-dinitrobenzaldehyde is sourced from PubChem (CID 91286899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).