C6H2F3NO3 — CID 131582853
2,3,4-trifluoro-5-nitrophenol (PubChem CID 131582853) has the molecular formula C6H2F3NO3 and a molecular weight of 193.08 g/mol. Its IUPAC name is 2,3,4-trifluoro-5-nitrophenol.
| Compound Name | 2,3,4-trifluoro-5-nitrophenol |
|---|---|
| PubChem CID | 131582853 |
| Molecular Formula | C6H2F3NO3 |
| Molecular Weight | 193.08 g/mol |
| Exact Mass | 193.00 |
| IUPAC Name | 2,3,4-trifluoro-5-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(O)c(F)c(F)c1F |
| InChI | InChI=1S/C6H2F3NO3/c7-4-2(10(12)13)1-3(11)5(8)6(4)9/h1,11H |
| InChIKey | KROCDBXBGMNBFH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.08 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|