C7H4F3NO2S — CID 12700918
1,3,4-trifluoro-2-methylsulfanyl-5-nitrobenzene (PubChem CID 12700918) has the molecular formula C7H4F3NO2S and a molecular weight of 223.17 g/mol. Its IUPAC name is 1,3,4-trifluoro-2-methylsulfanyl-5-nitrobenzene.
| Compound Name | 1,3,4-trifluoro-2-methylsulfanyl-5-nitrobenzene |
|---|---|
| PubChem CID | 12700918 |
| Molecular Formula | C7H4F3NO2S |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | 1,3,4-trifluoro-2-methylsulfanyl-5-nitrobenzene |
| SMILES | CSc1c(F)cc([N+](=O)[O-])c(F)c1F |
| InChI | InChI=1S/C7H4F3NO2S/c1-14-7-3(8)2-4(11(12)13)5(9)6(7)10/h2H,1H3 |
| InChIKey | MKFRFPOTFGEOEG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|