C12H2F7NO2 — CID 118815275
1-(2,5-difluoro-4-nitrophenyl)-2,3,4,5,6-pentafluorobenzene (PubChem CID 118815275) has the molecular formula C12H2F7NO2 and a molecular weight of 325.14 g/mol. Its IUPAC name is 1-(2,5-difluoro-4-nitrophenyl)-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(2,5-difluoro-4-nitrophenyl)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 118815275 |
| Molecular Formula | C12H2F7NO2 |
| Molecular Weight | 325.14 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 1-(2,5-difluoro-4-nitrophenyl)-2,3,4,5,6-pentafluorobenzene |
| SMILES | O=[N+]([O-])c1cc(F)c(-c2c(F)c(F)c(F)c(F)c2F)cc1F |
| InChI | InChI=1S/C12H2F7NO2/c13-4-2-6(20(21)22)5(14)1-3(4)7-8(15)10(17)12(19)11(18)9(7)16/h1-2H |
| InChIKey | FMPUWAJFYGFDTN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.14 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|