C12H2F7NO3 — CID 175575752
3,6-difluoro-2-nitro-4-(2,3,4,5,6-pentafluorophenyl)phenol (PubChem CID 175575752) has the molecular formula C12H2F7NO3 and a molecular weight of 341.14 g/mol. Its IUPAC name is 3,6-difluoro-2-nitro-4-(2,3,4,5,6-pentafluorophenyl)phenol.
| Compound Name | 3,6-difluoro-2-nitro-4-(2,3,4,5,6-pentafluorophenyl)phenol |
|---|---|
| PubChem CID | 175575752 |
| Molecular Formula | C12H2F7NO3 |
| Molecular Weight | 341.14 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 3,6-difluoro-2-nitro-4-(2,3,4,5,6-pentafluorophenyl)phenol |
| SMILES | O=[N+]([O-])c1c(O)c(F)cc(-c2c(F)c(F)c(F)c(F)c2F)c1F |
| InChI | InChI=1S/C12H2F7NO3/c13-3-1-2(5(14)11(12(3)21)20(22)23)4-6(15)8(17)10(19)9(18)7(4)16/h1,21H |
| InChIKey | DMJOHDUKTOMCIM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|