C24H2F15NO2 — CID 139110937
1,2,3,4,5-pentafluoro-6-[4-nitro-3,5-bis(2,3,4,5,6-pentafluorophenyl)phenyl]benzene (PubChem CID 139110937) has the molecular formula C24H2F15NO2 and a molecular weight of 621.25 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[4-nitro-3,5-bis(2,3,4,5,6-pentafluorophenyl)phenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[4-nitro-3,5-bis(2,3,4,5,6-pentafluorophenyl)phenyl]benzene |
|---|---|
| PubChem CID | 139110937 |
| Molecular Formula | C24H2F15NO2 |
| Molecular Weight | 621.25 g/mol |
| Exact Mass | 620.98 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[4-nitro-3,5-bis(2,3,4,5,6-pentafluorophenyl)phenyl]benzene |
| SMILES | O=[N+]([O-])c1c(-c2c(F)c(F)c(F)c(F)c2F)cc(-c2c(F)c(F)c(F)c(F)c2F)cc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H2F15NO2/c25-9-6(10(26)16(32)21(37)15(9)31)3-1-4(7-11(27)17(33)22(38)18(34)12(7)28)24(40(41)42)5(2-3)8-13(29)19(35)23(39)20(36)14(8)30/h1-2H |
| InChIKey | SZNWTLOAGCTQPU-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.25 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|